| Name | Diethyl pimelate |
| Synonyms | DIETHYL PIMELATE Diethyl pimelate Diethyl pimelic acid DIETHYL HEPTANEDIOATE Diethyl heptanedioate Pimlicaciddiethylester PIMELIC ACID DIETHYL ESTER PIMETIC ACID DIETHYL ESTER Pimelic acid diethyl ester heptanedioicaciddiethylester Heptanedioic acid, diethyl ester PENTAN-1,5-DICARBOXYLIC ACID DIETHYL ESTER Diethyl pimelate,(Pimelic acid diethyl ester) Heptanedioic acid diethyl ester~Pimelic acid diethyl ester |
| CAS | 2050-20-6 |
| EINECS | 218-083-9 |
| InChI | InChI=1/C11H20O4/c1-3-14-10(12)8-6-5-7-9-11(13)15-4-2/h3-9H2,1-2H3 |
| Molecular Formula | C11H20O4 |
| Molar Mass | 216.27 |
| Density | 0.994g/mLat 25°C(lit.) |
| Melting Point | -24°C |
| Boling Point | 192-194°C100mm Hg(lit.) |
| Flash Point | >230°F |
| Solubility | 1.97g/l slightly soluble |
| Vapor Presure | 0.0081mmHg at 25°C |
| Appearance | Transparent liquid |
| Color | Colourless |
| Merck | 14,7431 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.430(lit.) |
| MDL | MFCD00009216 |
| Physical and Chemical Properties | Colorless transparent liquid. Melting Point -24 ℃, boiling point of 252-255 ℃(99.7kPa), relative density of 0.9945(20/4 ℃), refractive index of 1.4305. Soluble in ethanol, ethyl ether, ethyl acetate, insoluble in water. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | UV9702000 |
| HS Code | 29171990 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| use | for organic synthesis. |
| Production method | It is obtained by esterification of pimelic acid and absolute ethanol in the presence of concentrated sulfuric acid. |